C20H18ClF3N2O2 — CID 87585696
(2S)-2-(chloroamino)-3-[2-methyl-1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]propanoic acid (PubChem CID 87585696) has the molecular formula C20H18ClF3N2O2 and a molecular weight of 410.82 g/mol. Its IUPAC name is (2S)-2-(chloroamino)-3-[2-methyl-1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]propanoic acid.
| Compound Name | (2S)-2-(chloroamino)-3-[2-methyl-1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]propanoic acid |
|---|---|
| PubChem CID | 87585696 |
| Molecular Formula | C20H18ClF3N2O2 |
| Molecular Weight | 410.82 g/mol |
| Exact Mass | 410.10 |
| IUPAC Name | (2S)-2-(chloroamino)-3-[2-methyl-1-[[4-(trifluoromethyl)phenyl]methyl]indol-3-yl]propanoic acid |
| SMILES | Cc1c(C[C@H](NCl)C(=O)O)c2ccccc2n1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H18ClF3N2O2/c1-12-16(10-17(25-21)19(27)28)15-4-2-3-5-18(15)26(12)11-13-6-8-14(9-7-13)20(22,23)24/h2-9,17,25H,10-11H2,1H3,(H,27,28)/t17-/m0/s1 |
| InChIKey | FSXHVTGJIOVDGA-KRWDZBQOSA-N |
| XLogP | 4.76 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.82 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|