C23H24BrNO4 — CID 134906794
dimethyl 2-[2-[1-[(4-bromophenyl)methyl]-2-methylindol-3-yl]ethyl]propanedioate (PubChem CID 134906794) has the molecular formula C23H24BrNO4 and a molecular weight of 458.35 g/mol. Its IUPAC name is dimethyl 2-[2-[1-[(4-bromophenyl)methyl]-2-methylindol-3-yl]ethyl]propanedioate.
| Compound Name | dimethyl 2-[2-[1-[(4-bromophenyl)methyl]-2-methylindol-3-yl]ethyl]propanedioate |
|---|---|
| PubChem CID | 134906794 |
| Molecular Formula | C23H24BrNO4 |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | dimethyl 2-[2-[1-[(4-bromophenyl)methyl]-2-methylindol-3-yl]ethyl]propanedioate |
| SMILES | COC(=O)C(CCc1c(C)n(Cc2ccc(Br)cc2)c2ccccc12)C(=O)OC |
| InChI | InChI=1S/C23H24BrNO4/c1-15-18(12-13-20(22(26)28-2)23(27)29-3)19-6-4-5-7-21(19)25(15)14-16-8-10-17(24)11-9-16/h4-11,20H,12-14H2,1-3H3 |
| InChIKey | ONCWXTXDSYBBJV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|