C24H26BrNO5 — CID 134906995
dimethyl 2-[2-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]ethyl]propanedioate (PubChem CID 134906995) has the molecular formula C24H26BrNO5 and a molecular weight of 488.38 g/mol. Its IUPAC name is dimethyl 2-[2-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]ethyl]propanedioate.
| Compound Name | dimethyl 2-[2-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]ethyl]propanedioate |
|---|---|
| PubChem CID | 134906995 |
| Molecular Formula | C24H26BrNO5 |
| Molecular Weight | 488.38 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | dimethyl 2-[2-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]ethyl]propanedioate |
| SMILES | COC(=O)C(CCc1c(C)n(Cc2ccc(Br)cc2)c2ccc(OC)cc12)C(=O)OC |
| InChI | InChI=1S/C24H26BrNO5/c1-15-19(10-11-20(23(27)30-3)24(28)31-4)21-13-18(29-2)9-12-22(21)26(15)14-16-5-7-17(25)8-6-16/h5-9,12-13,20H,10-11,14H2,1-4H3 |
| InChIKey | WAYSVDUHCSHPEL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|