C19H19BrClNO — CID 18768714
3-(2-bromoethyl)-1-[(4-chlorophenyl)methyl]-5-methoxy-2-methylindole (PubChem CID 18768714) has the molecular formula C19H19BrClNO and a molecular weight of 392.72 g/mol. Its IUPAC name is 3-(2-bromoethyl)-1-[(4-chlorophenyl)methyl]-5-methoxy-2-methylindole.
| Compound Name | 3-(2-bromoethyl)-1-[(4-chlorophenyl)methyl]-5-methoxy-2-methylindole |
|---|---|
| PubChem CID | 18768714 |
| Molecular Formula | C19H19BrClNO |
| Molecular Weight | 392.72 g/mol |
| Exact Mass | 391.03 |
| IUPAC Name | 3-(2-bromoethyl)-1-[(4-chlorophenyl)methyl]-5-methoxy-2-methylindole |
| SMILES | COc1ccc2c(c1)c(CCBr)c(C)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19BrClNO/c1-13-17(9-10-20)18-11-16(23-2)7-8-19(18)22(13)12-14-3-5-15(21)6-4-14/h3-8,11H,9-10,12H2,1-2H3 |
| InChIKey | ZTKJKZVEZUKEAD-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.72 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|