C25H29ClN2O7 — CID 87775141
2-[1-[(4-chlorophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-N-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide (PubChem CID 87775141) has the molecular formula C25H29ClN2O7 and a molecular weight of 504.97 g/mol. Its IUPAC name is 2-[1-[(4-chlorophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-N-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide.
| Compound Name | 2-[1-[(4-chlorophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-N-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide |
|---|---|
| PubChem CID | 87775141 |
| Molecular Formula | C25H29ClN2O7 |
| Molecular Weight | 504.97 g/mol |
| Exact Mass | 504.17 |
| IUPAC Name | 2-[1-[(4-chlorophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-N-[(2S,3R,4S,5R)-3,4,5,6-tetrahydroxy-1-oxohexan-2-yl]acetamide |
| SMILES | COc1ccc2c(c1)c(CC(=O)N[C@H](C=O)[C@@H](O)[C@H](O)[C@H](O)CO)c(C)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H29ClN2O7/c1-14-18(10-23(32)27-20(12-29)24(33)25(34)22(31)13-30)19-9-17(35-2)7-8-21(19)28(14)11-15-3-5-16(26)6-4-15/h3-9,12,20,22,24-25,30-31,33-34H,10-11,13H2,1-2H3,(H,27,32)/t20-,22-,24-,25-/m1/s1 |
| InChIKey | XAUXQUGDVJXLGT-NBUHOVDFSA-N |
| XLogP | 0.96 |
| TPSA | 141.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.97 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|