C19H19ClN2O4 — CID 10292821
2-[1-[(4-chlorophenyl)methyl]-5-methoxy-2-methylindol-3-yl]ethyl nitrate (PubChem CID 10292821) has the molecular formula C19H19ClN2O4 and a molecular weight of 374.82 g/mol. Its IUPAC name is 2-[1-[(4-chlorophenyl)methyl]-5-methoxy-2-methylindol-3-yl]ethyl nitrate.
| Compound Name | 2-[1-[(4-chlorophenyl)methyl]-5-methoxy-2-methylindol-3-yl]ethyl nitrate |
|---|---|
| PubChem CID | 10292821 |
| Molecular Formula | C19H19ClN2O4 |
| Molecular Weight | 374.82 g/mol |
| Exact Mass | 374.10 |
| IUPAC Name | 2-[1-[(4-chlorophenyl)methyl]-5-methoxy-2-methylindol-3-yl]ethyl nitrate |
| SMILES | COc1ccc2c(c1)c(CCO[N+](=O)[O-])c(C)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H19ClN2O4/c1-13-17(9-10-26-22(23)24)18-11-16(25-2)7-8-19(18)21(13)12-14-3-5-15(20)6-4-14/h3-8,11H,9-10,12H2,1-2H3 |
| InChIKey | PBPMQGCWLZPSRD-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 66.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.82 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|