C24H29NO2 — CID 59848564
(4R)-5-[5-methoxy-2-methyl-1-[(4-methylphenyl)methyl]indol-3-yl]-4-methylpentan-2-one (PubChem CID 59848564) has the molecular formula C24H29NO2 and a molecular weight of 363.50 g/mol. Its IUPAC name is (4R)-5-[5-methoxy-2-methyl-1-[(4-methylphenyl)methyl]indol-3-yl]-4-methylpentan-2-one.
| Compound Name | (4R)-5-[5-methoxy-2-methyl-1-[(4-methylphenyl)methyl]indol-3-yl]-4-methylpentan-2-one |
|---|---|
| PubChem CID | 59848564 |
| Molecular Formula | C24H29NO2 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.22 |
| IUPAC Name | (4R)-5-[5-methoxy-2-methyl-1-[(4-methylphenyl)methyl]indol-3-yl]-4-methylpentan-2-one |
| SMILES | COc1ccc2c(c1)c(C[C@@H](C)CC(C)=O)c(C)n2Cc1ccc(C)cc1 |
| InChI | InChI=1S/C24H29NO2/c1-16-6-8-20(9-7-16)15-25-19(4)22(13-17(2)12-18(3)26)23-14-21(27-5)10-11-24(23)25/h6-11,14,17H,12-13,15H2,1-5H3/t17-/m0/s1 |
| InChIKey | VXFWNKREMXHPQW-KRWDZBQOSA-N |
| XLogP | 5.47 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|