C22H24BrNO4 — CID 19041632
4-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-2-hydroxy-2-methylbutanoic acid (PubChem CID 19041632) has the molecular formula C22H24BrNO4 and a molecular weight of 446.34 g/mol. Its IUPAC name is 4-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-2-hydroxy-2-methylbutanoic acid.
| Compound Name | 4-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-2-hydroxy-2-methylbutanoic acid |
|---|---|
| PubChem CID | 19041632 |
| Molecular Formula | C22H24BrNO4 |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 4-[1-[(4-bromophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-2-hydroxy-2-methylbutanoic acid |
| SMILES | COc1ccc2c(c1)c(CCC(C)(O)C(=O)O)c(C)n2Cc1ccc(Br)cc1 |
| InChI | InChI=1S/C22H24BrNO4/c1-14-18(10-11-22(2,27)21(25)26)19-12-17(28-3)8-9-20(19)24(14)13-15-4-6-16(23)7-5-15/h4-9,12,27H,10-11,13H2,1-3H3,(H,25,26) |
| InChIKey | MZPHSSCFBYXZJT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|