C22H24INO3 — CID 19041694
4-[1-[(4-iodophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-3-methylbutanoic acid (PubChem CID 19041694) has the molecular formula C22H24INO3 and a molecular weight of 477.34 g/mol. Its IUPAC name is 4-[1-[(4-iodophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-3-methylbutanoic acid.
| Compound Name | 4-[1-[(4-iodophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 19041694 |
| Molecular Formula | C22H24INO3 |
| Molecular Weight | 477.34 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | 4-[1-[(4-iodophenyl)methyl]-5-methoxy-2-methylindol-3-yl]-3-methylbutanoic acid |
| SMILES | COc1ccc2c(c1)c(CC(C)CC(=O)O)c(C)n2Cc1ccc(I)cc1 |
| InChI | InChI=1S/C22H24INO3/c1-14(11-22(25)26)10-19-15(2)24(13-16-4-6-17(23)7-5-16)21-9-8-18(27-3)12-20(19)21/h4-9,12,14H,10-11,13H2,1-3H3,(H,25,26) |
| InChIKey | JXIZLUXKXQHAQZ-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.34 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|