C20H22ClN3O — CID 127039961
4-[[3-(2-aminoethyl)-5-methoxy-2-methylindol-1-yl]methyl]benzonitrile;hydrochloride (PubChem CID 127039961) has the molecular formula C20H22ClN3O and a molecular weight of 355.87 g/mol. Its IUPAC name is 4-[[3-(2-aminoethyl)-5-methoxy-2-methylindol-1-yl]methyl]benzonitrile;hydrochloride.
| Compound Name | 4-[[3-(2-aminoethyl)-5-methoxy-2-methylindol-1-yl]methyl]benzonitrile;hydrochloride |
|---|---|
| PubChem CID | 127039961 |
| Molecular Formula | C20H22ClN3O |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 4-[[3-(2-aminoethyl)-5-methoxy-2-methylindol-1-yl]methyl]benzonitrile;hydrochloride |
| SMILES | COc1ccc2c(c1)c(CCN)c(C)n2Cc1ccc(C#N)cc1.Cl |
| InChI | InChI=1S/C20H21N3O.ClH/c1-14-18(9-10-21)19-11-17(24-2)7-8-20(19)23(14)13-16-5-3-15(12-22)4-6-16;/h3-8,11H,9-10,13,21H2,1-2H3;1H |
| InChIKey | YMRUVHMEEWWIQP-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 63.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|