C19H21ClN2S — CID 129314883
2-[1-[(4-chlorophenyl)methyl]-2-methyl-5-methylsulfanylindol-3-yl]ethanamine (PubChem CID 129314883) has the molecular formula C19H21ClN2S and a molecular weight of 344.91 g/mol. Its IUPAC name is 2-[1-[(4-chlorophenyl)methyl]-2-methyl-5-methylsulfanylindol-3-yl]ethanamine.
| Compound Name | 2-[1-[(4-chlorophenyl)methyl]-2-methyl-5-methylsulfanylindol-3-yl]ethanamine |
|---|---|
| PubChem CID | 129314883 |
| Molecular Formula | C19H21ClN2S |
| Molecular Weight | 344.91 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 2-[1-[(4-chlorophenyl)methyl]-2-methyl-5-methylsulfanylindol-3-yl]ethanamine |
| SMILES | CSc1ccc2c(c1)c(CCN)c(C)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H21ClN2S/c1-13-17(9-10-21)18-11-16(23-2)7-8-19(18)22(13)12-14-3-5-15(20)6-4-14/h3-8,11H,9-10,12,21H2,1-2H3 |
| InChIKey | DQCREJUTJBDHEL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.91 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|