C23H24ClN3O10S — CID 11854080
2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]ethyl N-(3-nitrooxypropoxysulfonyl)carbamate (PubChem CID 11854080) has the molecular formula C23H24ClN3O10S and a molecular weight of 569.98 g/mol. Its IUPAC name is 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]ethyl N-(3-nitrooxypropoxysulfonyl)carbamate.
| Compound Name | 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]ethyl N-(3-nitrooxypropoxysulfonyl)carbamate |
|---|---|
| PubChem CID | 11854080 |
| Molecular Formula | C23H24ClN3O10S |
| Molecular Weight | 569.98 g/mol |
| Exact Mass | 569.09 |
| IUPAC Name | 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]ethyl N-(3-nitrooxypropoxysulfonyl)carbamate |
| SMILES | COc1ccc2c(c1)c(CCOC(=O)NS(=O)(=O)OCCCO[N+](=O)[O-])c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H24ClN3O10S/c1-15-19(10-13-35-23(29)25-38(32,33)37-12-3-11-36-27(30)31)20-14-18(34-2)8-9-21(20)26(15)22(28)16-4-6-17(24)7-5-16/h4-9,14H,3,10-13H2,1-2H3,(H,25,29) |
| InChIKey | JJYILYOKCKUZGB-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 165.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.98 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|