C19H18ClNO2 — CID 15320026
(4-chlorophenyl)-(3-ethyl-5-methoxy-2-methylindol-1-yl)methanone (PubChem CID 15320026) has the molecular formula C19H18ClNO2 and a molecular weight of 327.81 g/mol. Its IUPAC name is (4-chlorophenyl)-(3-ethyl-5-methoxy-2-methylindol-1-yl)methanone.
| Compound Name | (4-chlorophenyl)-(3-ethyl-5-methoxy-2-methylindol-1-yl)methanone |
|---|---|
| PubChem CID | 15320026 |
| Molecular Formula | C19H18ClNO2 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | (4-chlorophenyl)-(3-ethyl-5-methoxy-2-methylindol-1-yl)methanone |
| SMILES | CCc1c(C)n(C(=O)c2ccc(Cl)cc2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C19H18ClNO2/c1-4-16-12(2)21(18-10-9-15(23-3)11-17(16)18)19(22)13-5-7-14(20)8-6-13/h5-11H,4H2,1-3H3 |
| InChIKey | SFWPKKAWFSDSPB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |