C25H18Cl3NO3S — CID 22765709
S-(2,5-dichlorophenyl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]ethanethioate (PubChem CID 22765709) has the molecular formula C25H18Cl3NO3S and a molecular weight of 518.85 g/mol. Its IUPAC name is S-(2,5-dichlorophenyl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]ethanethioate.
| Compound Name | S-(2,5-dichlorophenyl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]ethanethioate |
|---|---|
| PubChem CID | 22765709 |
| Molecular Formula | C25H18Cl3NO3S |
| Molecular Weight | 518.85 g/mol |
| Exact Mass | 517.01 |
| IUPAC Name | S-(2,5-dichlorophenyl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]ethanethioate |
| SMILES | COc1ccc2c(c1)c(CC(=O)Sc1cc(Cl)ccc1Cl)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H18Cl3NO3S/c1-14-19(13-24(30)33-23-11-17(27)7-9-21(23)28)20-12-18(32-2)8-10-22(20)29(14)25(31)15-3-5-16(26)6-4-15/h3-12H,13H2,1-2H3 |
| InChIKey | AUOJZJKEMJZWDG-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.85 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|