C22H22ClN3O5 — CID 66813186
2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethylcarbamic acid (PubChem CID 66813186) has the molecular formula C22H22ClN3O5 and a molecular weight of 443.89 g/mol. Its IUPAC name is 2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethylcarbamic acid.
| Compound Name | 2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethylcarbamic acid |
|---|---|
| PubChem CID | 66813186 |
| Molecular Formula | C22H22ClN3O5 |
| Molecular Weight | 443.89 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethylcarbamic acid |
| SMILES | COc1ccc2c(c1)c(CC(=O)NCCNC(=O)O)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H22ClN3O5/c1-13-17(12-20(27)24-9-10-25-22(29)30)18-11-16(31-2)7-8-19(18)26(13)21(28)14-3-5-15(23)6-4-14/h3-8,11,25H,9-10,12H2,1-2H3,(H,24,27)(H,29,30) |
| InChIKey | PWZZLOWSHKHVNQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.89 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|