C41H50ClN3O4 — CID 71293802
N-[2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide (PubChem CID 71293802) has the molecular formula C41H50ClN3O4 and a molecular weight of 684.32 g/mol. Its IUPAC name is N-[2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide.
| Compound Name | N-[2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide |
|---|---|
| PubChem CID | 71293802 |
| Molecular Formula | C41H50ClN3O4 |
| Molecular Weight | 684.32 g/mol |
| Exact Mass | 683.35 |
| IUPAC Name | N-[2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyl]icosa-5,8,11,14,17-pentaenamide |
| SMILES | CCC=CCC=CCC=CCC=CCC=CCCCC(=O)NCCNC(=O)Cc1c(C)n(C(=O)c2ccc(Cl)cc2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C41H50ClN3O4/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-39(46)43-28-29-44-40(47)31-36-32(2)45(38-27-26-35(49-3)30-37(36)38)41(48)33-22-24-34(42)25-23-33/h5-6,8-9,11-12,14-15,17-18,22-27,30H,4,7,10,13,16,19-21,28-29,31H2,1-3H3,(H,43,46)(H,44,47) |
| InChIKey | ANDAFKHPQACWAO-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.32 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|