C22H20ClN3O3Se — CID 134689877
2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyl selenocyanate (PubChem CID 134689877) has the molecular formula C22H20ClN3O3Se and a molecular weight of 488.83 g/mol. Its IUPAC name is 2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyl selenocyanate.
| Compound Name | 2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyl selenocyanate |
|---|---|
| PubChem CID | 134689877 |
| Molecular Formula | C22H20ClN3O3Se |
| Molecular Weight | 488.83 g/mol |
| Exact Mass | 489.04 |
| IUPAC Name | 2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyl selenocyanate |
| SMILES | COc1ccc2c(c1)c(CC(=O)NCC[Se]C#N)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H20ClN3O3Se/c1-14-18(12-21(27)25-9-10-30-13-24)19-11-17(29-2)7-8-20(19)26(14)22(28)15-3-5-16(23)6-4-15/h3-8,11H,9-10,12H2,1-2H3,(H,25,27) |
| InChIKey | VEZQOWOSUNVNHH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 84.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.83 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|