C21H17ClN2O3Se — CID 171342260
Se-(cyanomethyl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]ethaneselenoate (PubChem CID 171342260) has the molecular formula C21H17ClN2O3Se and a molecular weight of 459.79 g/mol. Its IUPAC name is Se-(cyanomethyl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]ethaneselenoate.
| Compound Name | Se-(cyanomethyl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]ethaneselenoate |
|---|---|
| PubChem CID | 171342260 |
| Molecular Formula | C21H17ClN2O3Se |
| Molecular Weight | 459.79 g/mol |
| Exact Mass | 460.01 |
| IUPAC Name | Se-(cyanomethyl) 2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]ethaneselenoate |
| SMILES | COc1ccc2c(c1)c(CC(=O)[Se]CC#N)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17ClN2O3Se/c1-13-17(12-20(25)28-10-9-23)18-11-16(27-2)7-8-19(18)24(13)21(26)14-3-5-15(22)6-4-14/h3-8,11H,10,12H2,1-2H3 |
| InChIKey | WHILEXLKSNUWMW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.79 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|