C23H24ClN3O6S2 — CID 54577978
2-[2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyldisulfanyl]ethyl nitrate (PubChem CID 54577978) has the molecular formula C23H24ClN3O6S2 and a molecular weight of 538.05 g/mol. Its IUPAC name is 2-[2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyldisulfanyl]ethyl nitrate.
| Compound Name | 2-[2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyldisulfanyl]ethyl nitrate |
|---|---|
| PubChem CID | 54577978 |
| Molecular Formula | C23H24ClN3O6S2 |
| Molecular Weight | 538.05 g/mol |
| Exact Mass | 537.08 |
| IUPAC Name | 2-[2-[[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]amino]ethyldisulfanyl]ethyl nitrate |
| SMILES | COc1ccc2c(c1)c(CC(=O)NCCSSCCO[N+](=O)[O-])c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H24ClN3O6S2/c1-15-19(14-22(28)25-9-11-34-35-12-10-33-27(30)31)20-13-18(32-2)7-8-21(20)26(15)23(29)16-3-5-17(24)6-4-16/h3-8,13H,9-12,14H2,1-2H3,(H,25,28) |
| InChIKey | NPANDVXZTYFZKZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 112.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.05 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|