C25H27ClN2O6S2 — CID 58608014
2-(2-methoxyethyldisulfanyl)ethyl N-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]carbamate (PubChem CID 58608014) has the molecular formula C25H27ClN2O6S2 and a molecular weight of 551.09 g/mol. Its IUPAC name is 2-(2-methoxyethyldisulfanyl)ethyl N-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]carbamate.
| Compound Name | 2-(2-methoxyethyldisulfanyl)ethyl N-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]carbamate |
|---|---|
| PubChem CID | 58608014 |
| Molecular Formula | C25H27ClN2O6S2 |
| Molecular Weight | 551.09 g/mol |
| Exact Mass | 550.10 |
| IUPAC Name | 2-(2-methoxyethyldisulfanyl)ethyl N-[2-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]acetyl]carbamate |
| SMILES | COCCSSCCOC(=O)NC(=O)Cc1c(C)n(C(=O)c2ccc(Cl)cc2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C25H27ClN2O6S2/c1-16-20(15-23(29)27-25(31)34-11-13-36-35-12-10-32-2)21-14-19(33-3)8-9-22(21)28(16)24(30)17-4-6-18(26)7-5-17/h4-9,14H,10-13,15H2,1-3H3,(H,27,29,31) |
| InChIKey | LZDURAJIVLGEMR-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.09 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|