C25H25ClN2O8S2 — CID 58607919
2-(2-nitrooxyethyldisulfanyl)ethyl 4-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-3-oxobutanoate (PubChem CID 58607919) has the molecular formula C25H25ClN2O8S2 and a molecular weight of 581.07 g/mol. Its IUPAC name is 2-(2-nitrooxyethyldisulfanyl)ethyl 4-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-3-oxobutanoate.
| Compound Name | 2-(2-nitrooxyethyldisulfanyl)ethyl 4-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-3-oxobutanoate |
|---|---|
| PubChem CID | 58607919 |
| Molecular Formula | C25H25ClN2O8S2 |
| Molecular Weight | 581.07 g/mol |
| Exact Mass | 580.07 |
| IUPAC Name | 2-(2-nitrooxyethyldisulfanyl)ethyl 4-[1-(4-chlorobenzoyl)-5-methoxy-2-methylindol-3-yl]-3-oxobutanoate |
| SMILES | COc1ccc2c(c1)c(CC(=O)CC(=O)OCCSSCCO[N+](=O)[O-])c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H25ClN2O8S2/c1-16-21(13-19(29)14-24(30)35-9-11-37-38-12-10-36-28(32)33)22-15-20(34-2)7-8-23(22)27(16)25(31)17-3-5-18(26)6-4-17/h3-8,15H,9-14H2,1-2H3 |
| InChIKey | KJHLNQJUUSVDTQ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 126.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.07 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|