C22H26ClN3O2S2 — CID 89427773
N-[2-(2-aminoethyldisulfanyl)ethyl]-2-[1-(4-chlorophenyl)-5-methoxy-2-methylindol-3-yl]acetamide (PubChem CID 89427773) has the molecular formula C22H26ClN3O2S2 and a molecular weight of 464.06 g/mol. Its IUPAC name is N-[2-(2-aminoethyldisulfanyl)ethyl]-2-[1-(4-chlorophenyl)-5-methoxy-2-methylindol-3-yl]acetamide.
| Compound Name | N-[2-(2-aminoethyldisulfanyl)ethyl]-2-[1-(4-chlorophenyl)-5-methoxy-2-methylindol-3-yl]acetamide |
|---|---|
| PubChem CID | 89427773 |
| Molecular Formula | C22H26ClN3O2S2 |
| Molecular Weight | 464.06 g/mol |
| Exact Mass | 463.12 |
| IUPAC Name | N-[2-(2-aminoethyldisulfanyl)ethyl]-2-[1-(4-chlorophenyl)-5-methoxy-2-methylindol-3-yl]acetamide |
| SMILES | COc1ccc2c(c1)c(CC(=O)NCCSSCCN)c(C)n2-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H26ClN3O2S2/c1-15-19(14-22(27)25-10-12-30-29-11-9-24)20-13-18(28-2)7-8-21(20)26(15)17-5-3-16(23)4-6-17/h3-8,13H,9-12,14,24H2,1-2H3,(H,25,27) |
| InChIKey | HOPNECZFSJBNOV-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.06 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|