C25H32ClNO3Si — CID 11641115
[3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methoxy-2-methylindol-1-yl]-(4-chlorophenyl)methanone (PubChem CID 11641115) has the molecular formula C25H32ClNO3Si and a molecular weight of 458.07 g/mol. Its IUPAC name is [3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methoxy-2-methylindol-1-yl]-(4-chlorophenyl)methanone.
| Compound Name | [3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methoxy-2-methylindol-1-yl]-(4-chlorophenyl)methanone |
|---|---|
| PubChem CID | 11641115 |
| Molecular Formula | C25H32ClNO3Si |
| Molecular Weight | 458.07 g/mol |
| Exact Mass | 457.18 |
| IUPAC Name | [3-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-methoxy-2-methylindol-1-yl]-(4-chlorophenyl)methanone |
| SMILES | COc1ccc2c(c1)c(CCO[Si](C)(C)C(C)(C)C)c(C)n2C(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H32ClNO3Si/c1-17-21(14-15-30-31(6,7)25(2,3)4)22-16-20(29-5)12-13-23(22)27(17)24(28)18-8-10-19(26)11-9-18/h8-13,16H,14-15H2,1-7H3 |
| InChIKey | MSPSIXIPPZFXQA-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.07 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|