C22H24ClNO4Si — CID 587439
methyl 2-[1-(4-chlorobenzoyl)-2-methyl-5-trimethylsilyloxyindol-3-yl]acetate (PubChem CID 587439) has the molecular formula C22H24ClNO4Si and a molecular weight of 429.98 g/mol. Its IUPAC name is methyl 2-[1-(4-chlorobenzoyl)-2-methyl-5-trimethylsilyloxyindol-3-yl]acetate.
| Compound Name | methyl 2-[1-(4-chlorobenzoyl)-2-methyl-5-trimethylsilyloxyindol-3-yl]acetate |
|---|---|
| PubChem CID | 587439 |
| Molecular Formula | C22H24ClNO4Si |
| Molecular Weight | 429.98 g/mol |
| Exact Mass | 429.12 |
| IUPAC Name | methyl 2-[1-(4-chlorobenzoyl)-2-methyl-5-trimethylsilyloxyindol-3-yl]acetate |
| SMILES | COC(=O)Cc1c(C)n(C(=O)c2ccc(Cl)cc2)c2ccc(O[Si](C)(C)C)cc12 |
| InChI | InChI=1S/C22H24ClNO4Si/c1-14-18(13-21(25)27-2)19-12-17(28-29(3,4)5)10-11-20(19)24(14)22(26)15-6-8-16(23)9-7-15/h6-12H,13H2,1-5H3 |
| InChIKey | SJRVBOUECWMUGH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.98 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|