C28H24F3NO3 — CID 150721720
2-[1-[(4-tert-butylphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]indol-3-yl]-2-oxoacetic acid (PubChem CID 150721720) has the molecular formula C28H24F3NO3 and a molecular weight of 479.50 g/mol. Its IUPAC name is 2-[1-[(4-tert-butylphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]indol-3-yl]-2-oxoacetic acid.
| Compound Name | 2-[1-[(4-tert-butylphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]indol-3-yl]-2-oxoacetic acid |
|---|---|
| PubChem CID | 150721720 |
| Molecular Formula | C28H24F3NO3 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 2-[1-[(4-tert-butylphenyl)methyl]-2-[4-(trifluoromethyl)phenyl]indol-3-yl]-2-oxoacetic acid |
| SMILES | CC(C)(C)c1ccc(Cn2c(-c3ccc(C(F)(F)F)cc3)c(C(=O)C(=O)O)c3ccccc32)cc1 |
| InChI | InChI=1S/C28H24F3NO3/c1-27(2,3)19-12-8-17(9-13-19)16-32-22-7-5-4-6-21(22)23(25(33)26(34)35)24(32)18-10-14-20(15-11-18)28(29,30)31/h4-15H,16H2,1-3H3,(H,34,35) |
| InChIKey | JPZOEFWZAWNJJS-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 59.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|