C32H31N3O — CID 4022529
2-[3-[(4-tert-butylphenyl)methyl]-2-iminobenzimidazol-1-yl]-1-(4-phenylphenyl)ethanone (PubChem CID 4022529) has the molecular formula C32H31N3O and a molecular weight of 473.62 g/mol. Its IUPAC name is 2-[3-[(4-tert-butylphenyl)methyl]-2-iminobenzimidazol-1-yl]-1-(4-phenylphenyl)ethanone.
| Compound Name | 2-[3-[(4-tert-butylphenyl)methyl]-2-iminobenzimidazol-1-yl]-1-(4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 4022529 |
| Molecular Formula | C32H31N3O |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | 2-[3-[(4-tert-butylphenyl)methyl]-2-iminobenzimidazol-1-yl]-1-(4-phenylphenyl)ethanone |
| SMILES | [H]/N=c1\n(CC(=O)c2ccc(-c3ccccc3)cc2)c2ccccc2n1Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H31N3O/c1-32(2,3)27-19-13-23(14-20-27)21-34-28-11-7-8-12-29(28)35(31(34)33)22-30(36)26-17-15-25(16-18-26)24-9-5-4-6-10-24/h4-20,33H,21-22H2,1-3H3/b33-31- |
| InChIKey | UFLDZLKEKWGTQH-FPODKLOTSA-N |
| XLogP | 6.82 |
| TPSA | 50.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |