C26H29N3O — CID 1050683
1-benzyl-3-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-imine (PubChem CID 1050683) has the molecular formula C26H29N3O and a molecular weight of 399.54 g/mol. Its IUPAC name is 1-benzyl-3-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-imine.
| Compound Name | 1-benzyl-3-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-imine |
|---|---|
| PubChem CID | 1050683 |
| Molecular Formula | C26H29N3O |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | 1-benzyl-3-[2-(4-tert-butylphenoxy)ethyl]benzimidazol-2-imine |
| SMILES | [H]/N=c1\n(CCOc2ccc(C(C)(C)C)cc2)c2ccccc2n1Cc1ccccc1 |
| InChI | InChI=1S/C26H29N3O/c1-26(2,3)21-13-15-22(16-14-21)30-18-17-28-23-11-7-8-12-24(23)29(25(28)27)19-20-9-5-4-6-10-20/h4-16,27H,17-19H2,1-3H3/b27-25+ |
| InChIKey | PVJHBFYUJYLZTO-IMVLJIQESA-N |
| XLogP | 5.35 |
| TPSA | 42.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |