C23H20Cl3N3O — CID 17272687
1-[3-(4-chlorophenoxy)propyl]-3-[(3,4-dichlorophenyl)methyl]benzimidazol-2-imine (PubChem CID 17272687) has the molecular formula C23H20Cl3N3O and a molecular weight of 460.79 g/mol. Its IUPAC name is 1-[3-(4-chlorophenoxy)propyl]-3-[(3,4-dichlorophenyl)methyl]benzimidazol-2-imine.
| Compound Name | 1-[3-(4-chlorophenoxy)propyl]-3-[(3,4-dichlorophenyl)methyl]benzimidazol-2-imine |
|---|---|
| PubChem CID | 17272687 |
| Molecular Formula | C23H20Cl3N3O |
| Molecular Weight | 460.79 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 1-[3-(4-chlorophenoxy)propyl]-3-[(3,4-dichlorophenyl)methyl]benzimidazol-2-imine |
| SMILES | [H]/N=c1\n(CCCOc2ccc(Cl)cc2)c2ccccc2n1Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C23H20Cl3N3O/c24-17-7-9-18(10-8-17)30-13-3-12-28-21-4-1-2-5-22(21)29(23(28)27)15-16-6-11-19(25)20(26)14-16/h1-2,4-11,14,27H,3,12-13,15H2/b27-23+ |
| InChIKey | ZFEQOWPFXSOOML-SLEBQGDGSA-N |
| XLogP | 6.40 |
| TPSA | 42.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.79 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|