C18H20FN3O — CID 22332685
1-ethyl-3-[3-(4-fluorophenoxy)propyl]benzimidazol-2-imine (PubChem CID 22332685) has the molecular formula C18H20FN3O and a molecular weight of 313.38 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4-fluorophenoxy)propyl]benzimidazol-2-imine.
| Compound Name | 1-ethyl-3-[3-(4-fluorophenoxy)propyl]benzimidazol-2-imine |
|---|---|
| PubChem CID | 22332685 |
| Molecular Formula | C18H20FN3O |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.16 |
| IUPAC Name | 1-ethyl-3-[3-(4-fluorophenoxy)propyl]benzimidazol-2-imine |
| SMILES | [H]/N=c1\n(CC)c2ccccc2n1CCCOc1ccc(F)cc1 |
| InChI | InChI=1S/C18H20FN3O/c1-2-21-16-6-3-4-7-17(16)22(18(21)20)12-5-13-23-15-10-8-14(19)9-11-15/h3-4,6-11,20H,2,5,12-13H2,1H3/b20-18+ |
| InChIKey | ZOUQJVDYGRCMOD-CZIZESTLSA-N |
| XLogP | 3.55 |
| TPSA | 42.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|