C24H23Cl2N3O2 — CID 17272709
1-[2-(2-chlorophenoxy)ethyl]-3-[3-(4-chlorophenoxy)propyl]benzimidazol-2-imine (PubChem CID 17272709) has the molecular formula C24H23Cl2N3O2 and a molecular weight of 456.37 g/mol. Its IUPAC name is 1-[2-(2-chlorophenoxy)ethyl]-3-[3-(4-chlorophenoxy)propyl]benzimidazol-2-imine.
| Compound Name | 1-[2-(2-chlorophenoxy)ethyl]-3-[3-(4-chlorophenoxy)propyl]benzimidazol-2-imine |
|---|---|
| PubChem CID | 17272709 |
| Molecular Formula | C24H23Cl2N3O2 |
| Molecular Weight | 456.37 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 1-[2-(2-chlorophenoxy)ethyl]-3-[3-(4-chlorophenoxy)propyl]benzimidazol-2-imine |
| SMILES | [H]/N=c1\n(CCCOc2ccc(Cl)cc2)c2ccccc2n1CCOc1ccccc1Cl |
| InChI | InChI=1S/C24H23Cl2N3O2/c25-18-10-12-19(13-11-18)30-16-5-14-28-21-7-2-3-8-22(21)29(24(28)27)15-17-31-23-9-4-1-6-20(23)26/h1-4,6-13,27H,5,14-17H2/b27-24+ |
| InChIKey | MYLIKTDLYMYIKB-SOYKGTTHSA-N |
| XLogP | 5.78 |
| TPSA | 52.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.37 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|