C11H16ClN3O — CID 2857928
2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanol;hydrochloride (PubChem CID 2857928) has the molecular formula C11H16ClN3O and a molecular weight of 241.72 g/mol. Its IUPAC name is 2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanol;hydrochloride.
| Compound Name | 2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanol;hydrochloride |
|---|---|
| PubChem CID | 2857928 |
| Molecular Formula | C11H16ClN3O |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.10 |
| IUPAC Name | 2-(3-ethyl-2-iminobenzimidazol-1-yl)ethanol;hydrochloride |
| SMILES | Cl.[H]/N=c1\n(CC)c2ccccc2n1CCO |
| InChI | InChI=1S/C11H15N3O.ClH/c1-2-13-9-5-3-4-6-10(9)14(7-8-15)11(13)12;/h3-6,12,15H,2,7-8H2,1H3;1H/b12-11+; |
| InChIKey | MTBFSLMPXGWFSB-CALJPSDSSA-N |
| XLogP | 1.36 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |