C13H16BrN3O2 — CID 2859648
methyl 2-(2-imino-3-prop-2-enylbenzimidazol-1-yl)acetate;hydrobromide (PubChem CID 2859648) has the molecular formula C13H16BrN3O2 and a molecular weight of 326.19 g/mol. Its IUPAC name is methyl 2-(2-imino-3-prop-2-enylbenzimidazol-1-yl)acetate;hydrobromide.
| Compound Name | methyl 2-(2-imino-3-prop-2-enylbenzimidazol-1-yl)acetate;hydrobromide |
|---|---|
| PubChem CID | 2859648 |
| Molecular Formula | C13H16BrN3O2 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | methyl 2-(2-imino-3-prop-2-enylbenzimidazol-1-yl)acetate;hydrobromide |
| SMILES | Br.[H]/N=c1\n(CC=C)c2ccccc2n1CC(=O)OC |
| InChI | InChI=1S/C13H15N3O2.BrH/c1-3-8-15-10-6-4-5-7-11(10)16(13(15)14)9-12(17)18-2;/h3-7,14H,1,8-9H2,2H3;1H/b14-13+; |
| InChIKey | SXHBPTIGRYXGQA-IERUDJENSA-N |
| XLogP | 1.86 |
| TPSA | 60.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|