C28H22ClN3O — CID 3124402
2-[3-[(2-chlorophenyl)methyl]-2-iminobenzimidazol-1-yl]-1-(4-phenylphenyl)ethanone (PubChem CID 3124402) has the molecular formula C28H22ClN3O and a molecular weight of 451.96 g/mol. Its IUPAC name is 2-[3-[(2-chlorophenyl)methyl]-2-iminobenzimidazol-1-yl]-1-(4-phenylphenyl)ethanone.
| Compound Name | 2-[3-[(2-chlorophenyl)methyl]-2-iminobenzimidazol-1-yl]-1-(4-phenylphenyl)ethanone |
|---|---|
| PubChem CID | 3124402 |
| Molecular Formula | C28H22ClN3O |
| Molecular Weight | 451.96 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | 2-[3-[(2-chlorophenyl)methyl]-2-iminobenzimidazol-1-yl]-1-(4-phenylphenyl)ethanone |
| SMILES | [H]/N=c1\n(CC(=O)c2ccc(-c3ccccc3)cc2)c2ccccc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C28H22ClN3O/c29-24-11-5-4-10-23(24)18-31-25-12-6-7-13-26(25)32(28(31)30)19-27(33)22-16-14-21(15-17-22)20-8-2-1-3-9-20/h1-17,30H,18-19H2/b30-28- |
| InChIKey | MRKQKMHZWRVWQN-HYOGKJQXSA-N |
| XLogP | 6.17 |
| TPSA | 50.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.96 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |