C22H17BrClN4O3- — CID 53347415
2-[3-[(2-chlorophenyl)methyl]-2-iminobenzimidazol-1-yl]-1-(4-nitrophenyl)ethanone bromide (PubChem CID 53347415) has the molecular formula C22H17BrClN4O3- and a molecular weight of 500.76 g/mol. Its IUPAC name is 2-[3-[(2-chlorophenyl)methyl]-2-iminobenzimidazol-1-yl]-1-(4-nitrophenyl)ethanone bromide.
| Compound Name | 2-[3-[(2-chlorophenyl)methyl]-2-iminobenzimidazol-1-yl]-1-(4-nitrophenyl)ethanone bromide |
|---|---|
| PubChem CID | 53347415 |
| Molecular Formula | C22H17BrClN4O3- |
| Molecular Weight | 500.76 g/mol |
| Exact Mass | 499.02 |
| IUPAC Name | 2-[3-[(2-chlorophenyl)methyl]-2-iminobenzimidazol-1-yl]-1-(4-nitrophenyl)ethanone bromide |
| SMILES | [Br-].[H]/N=c1\n(CC(=O)c2ccc([N+](=O)[O-])cc2)c2ccccc2n1Cc1ccccc1Cl |
| InChI | InChI=1S/C22H17ClN4O3.BrH/c23-18-6-2-1-5-16(18)13-25-19-7-3-4-8-20(19)26(22(25)24)14-21(28)15-9-11-17(12-10-15)27(29)30;/h1-12,24H,13-14H2;1H/p-1/b24-22-; |
| InChIKey | PJHJOVBRVDVIFB-WKKHQKTCSA-M |
| XLogP | 1.42 |
| TPSA | 93.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.76 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|