C21H23BrN5O4- — CID 53352017
2-[2-imino-3-(2-morpholin-4-ylethyl)benzimidazol-1-yl]-1-(3-nitrophenyl)ethanone bromide (PubChem CID 53352017) has the molecular formula C21H23BrN5O4- and a molecular weight of 489.35 g/mol. Its IUPAC name is 2-[2-imino-3-(2-morpholin-4-ylethyl)benzimidazol-1-yl]-1-(3-nitrophenyl)ethanone bromide.
| Compound Name | 2-[2-imino-3-(2-morpholin-4-ylethyl)benzimidazol-1-yl]-1-(3-nitrophenyl)ethanone bromide |
|---|---|
| PubChem CID | 53352017 |
| Molecular Formula | C21H23BrN5O4- |
| Molecular Weight | 489.35 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | 2-[2-imino-3-(2-morpholin-4-ylethyl)benzimidazol-1-yl]-1-(3-nitrophenyl)ethanone bromide |
| SMILES | [Br-].[H]/N=c1\n(CCN2CCOCC2)c2ccccc2n1CC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H23N5O4.BrH/c22-21-24(9-8-23-10-12-30-13-11-23)18-6-1-2-7-19(18)25(21)15-20(27)16-4-3-5-17(14-16)26(28)29;/h1-7,14,22H,8-13,15H2;1H/p-1/b22-21+; |
| InChIKey | AIARYWHQIJLWML-QUABFQRHSA-M |
| XLogP | -0.95 |
| TPSA | 106.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.35 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|