C22H18BrClN4O3 — CID 15944760
2-[3-[(4-chlorophenyl)methyl]-2-iminobenzimidazol-1-yl]-1-(4-nitrophenyl)ethanone;hydrobromide (PubChem CID 15944760) has the molecular formula C22H18BrClN4O3 and a molecular weight of 501.77 g/mol. Its IUPAC name is 2-[3-[(4-chlorophenyl)methyl]-2-iminobenzimidazol-1-yl]-1-(4-nitrophenyl)ethanone;hydrobromide.
| Compound Name | 2-[3-[(4-chlorophenyl)methyl]-2-iminobenzimidazol-1-yl]-1-(4-nitrophenyl)ethanone;hydrobromide |
|---|---|
| PubChem CID | 15944760 |
| Molecular Formula | C22H18BrClN4O3 |
| Molecular Weight | 501.77 g/mol |
| Exact Mass | 500.03 |
| IUPAC Name | 2-[3-[(4-chlorophenyl)methyl]-2-iminobenzimidazol-1-yl]-1-(4-nitrophenyl)ethanone;hydrobromide |
| SMILES | Br.[H]/N=c1\n(CC(=O)c2ccc([N+](=O)[O-])cc2)c2ccccc2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H17ClN4O3.BrH/c23-17-9-5-15(6-10-17)13-25-19-3-1-2-4-20(19)26(22(25)24)14-21(28)16-7-11-18(12-8-16)27(29)30;/h1-12,24H,13-14H2;1H/b24-22-; |
| InChIKey | PYZVDFZBLAUSMR-WKKHQKTCSA-N |
| XLogP | 4.99 |
| TPSA | 93.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.77 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|