C22H26N5O3+ — CID 2265068
2-[2-amino-3-(2-piperidin-1-ylethyl)benzimidazol-1-ium-1-yl]-1-(3-nitrophenyl)ethanone (PubChem CID 2265068) has the molecular formula C22H26N5O3+ and a molecular weight of 408.48 g/mol. Its IUPAC name is 2-[2-amino-3-(2-piperidin-1-ylethyl)benzimidazol-1-ium-1-yl]-1-(3-nitrophenyl)ethanone.
| Compound Name | 2-[2-amino-3-(2-piperidin-1-ylethyl)benzimidazol-1-ium-1-yl]-1-(3-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 2265068 |
| Molecular Formula | C22H26N5O3+ |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | 2-[2-amino-3-(2-piperidin-1-ylethyl)benzimidazol-1-ium-1-yl]-1-(3-nitrophenyl)ethanone |
| SMILES | Nc1n(CCN2CCCCC2)c2ccccc2[n+]1CC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H25N5O3/c23-22-25(14-13-24-11-4-1-5-12-24)19-9-2-3-10-20(19)26(22)16-21(28)17-7-6-8-18(15-17)27(29)30/h2-3,6-10,15,23H,1,4-5,11-14,16H2/p+1 |
| InChIKey | WUPRQQSXICDUSQ-UHFFFAOYSA-O |
| XLogP | 2.79 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|