About 2-piperidin-1-ylethyl 3-nitrobenzoate
2-piperidin-1-ylethyl 3-nitrobenzoate (PubChem CID 790139) has the molecular formula C14H18N2O4
and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl 3-nitrobenzoate.
Molecular Properties
| Compound Name | 2-piperidin-1-ylethyl 3-nitrobenzoate |
| PubChem CID | 790139 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-piperidin-1-ylethyl 3-nitrobenzoate |
| SMILES | O=C(OCCN1CCCCC1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H18N2O4/c17-14(12-5-4-6-13(11-12)16(18)19)20-10-9-15-7-2-1-3-8-15/h4-6,11H,1-3,7-10H2 |
| InChIKey | FEGMIBDDEIQHPE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-piperidin-1-ylethyl 3-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-1-ylethyl 3-nitrobenzoate?
The IUPAC name of 2-piperidin-1-ylethyl 3-nitrobenzoate (CID 790139) is 2-piperidin-1-ylethyl 3-nitrobenzoate.
What is the SMILES notation for 2-piperidin-1-ylethyl 3-nitrobenzoate?
The canonical SMILES for 2-piperidin-1-ylethyl 3-nitrobenzoate is O=C(OCCN1CCCCC1)c1cccc([N+](=O)[O-])c1.
What is the InChIKey of 2-piperidin-1-ylethyl 3-nitrobenzoate?
The InChIKey is FEGMIBDDEIQHPE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O4/c17-14(12-5-4-6-13(11-12)16(18)19)20-10-9-15-7-2-1-3-8-15/h4-6,11H,1-3,7-10H2.
What are the key properties of 2-piperidin-1-ylethyl 3-nitrobenzoate?
2-piperidin-1-ylethyl 3-nitrobenzoate has a molecular weight of 278.31 g/mol, XLogP of 2.24, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-1-ylethyl 3-nitrobenzoate is sourced from PubChem (CID 790139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).