C22H26FN4O+ — CID 76901109
2-[2-amino-3-(2-piperidin-1-ylethyl)benzimidazol-1-ium-1-yl]-1-(4-fluorophenyl)ethanone (PubChem CID 76901109) has the molecular formula C22H26FN4O+ and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-[2-amino-3-(2-piperidin-1-ylethyl)benzimidazol-1-ium-1-yl]-1-(4-fluorophenyl)ethanone.
| Compound Name | 2-[2-amino-3-(2-piperidin-1-ylethyl)benzimidazol-1-ium-1-yl]-1-(4-fluorophenyl)ethanone |
|---|---|
| PubChem CID | 76901109 |
| Molecular Formula | C22H26FN4O+ |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.21 |
| IUPAC Name | 2-[2-amino-3-(2-piperidin-1-ylethyl)benzimidazol-1-ium-1-yl]-1-(4-fluorophenyl)ethanone |
| SMILES | Nc1n(CCN2CCCCC2)c2ccccc2[n+]1CC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H25FN4O/c23-18-10-8-17(9-11-18)21(28)16-27-20-7-3-2-6-19(20)26(22(27)24)15-14-25-12-4-1-5-13-25/h2-3,6-11,24H,1,4-5,12-16H2/p+1 |
| InChIKey | SGKWODQMEJXXHX-UHFFFAOYSA-O |
| XLogP | 3.02 |
| TPSA | 55.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|