C18H17FN3O+ — CID 5038588
1-(4-fluorophenyl)-2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanone (PubChem CID 5038588) has the molecular formula C18H17FN3O+ and a molecular weight of 310.35 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanone.
| Compound Name | 1-(4-fluorophenyl)-2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanone |
|---|---|
| PubChem CID | 5038588 |
| Molecular Formula | C18H17FN3O+ |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | 1-(4-fluorophenyl)-2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethanone |
| SMILES | O=C(Cn1c2[n+](c3ccccc31)CCCN2)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H16FN3O/c19-14-8-6-13(7-9-14)17(23)12-22-16-5-2-1-4-15(16)21-11-3-10-20-18(21)22/h1-2,4-9H,3,10-12H2/p+1 |
| InChIKey | DOJUOVCNPMRSDP-UHFFFAOYSA-O |
| XLogP | 2.77 |
| TPSA | 37.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|