C17H26Cl2N4 — CID 44656117
10-(2-piperidin-1-ium-1-ylethyl)-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium dichloride (PubChem CID 44656117) has the molecular formula C17H26Cl2N4 and a molecular weight of 357.33 g/mol. Its IUPAC name is 10-(2-piperidin-1-ium-1-ylethyl)-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium dichloride.
| Compound Name | 10-(2-piperidin-1-ium-1-ylethyl)-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium dichloride |
|---|---|
| PubChem CID | 44656117 |
| Molecular Formula | C17H26Cl2N4 |
| Molecular Weight | 357.33 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 10-(2-piperidin-1-ium-1-ylethyl)-1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium dichloride |
| SMILES | [Cl-].[Cl-].c1ccc2c(c1)n(CC[NH+]1CCCCC1)c1[n+]2CCCN1 |
| InChI | InChI=1S/C17H24N4.2ClH/c1-4-10-19(11-5-1)13-14-21-16-8-3-2-7-15(16)20-12-6-9-18-17(20)21;;/h2-3,7-8H,1,4-6,9-14H2;2*1H |
| InChIKey | FBXCJELRIKCKPS-UHFFFAOYSA-N |
| XLogP | -5.18 |
| TPSA | 25.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.33 |
| LogP ≤ 5 | -5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|