C16H24Cl2N4O — CID 44657714
4-[2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethyl]morpholin-4-ium dichloride (PubChem CID 44657714) has the molecular formula C16H24Cl2N4O and a molecular weight of 359.30 g/mol. Its IUPAC name is 4-[2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethyl]morpholin-4-ium dichloride.
| Compound Name | 4-[2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethyl]morpholin-4-ium dichloride |
|---|---|
| PubChem CID | 44657714 |
| Molecular Formula | C16H24Cl2N4O |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | 4-[2-(1,2,3,4-tetrahydropyrimido[1,2-a]benzimidazol-5-ium-10-yl)ethyl]morpholin-4-ium dichloride |
| SMILES | [Cl-].[Cl-].c1ccc2c(c1)n(CC[NH+]1CCOCC1)c1[n+]2CCCN1 |
| InChI | InChI=1S/C16H22N4O.2ClH/c1-2-5-15-14(4-1)19-7-3-6-17-16(19)20(15)9-8-18-10-12-21-13-11-18;;/h1-2,4-5H,3,6-13H2;2*1H |
| InChIKey | CTRKDLNCPXJACX-UHFFFAOYSA-N |
| XLogP | -6.33 |
| TPSA | 34.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | -6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|