C20H34N4O+2 — CID 6942557
(2S)-1-[2-amino-3-(2-piperidin-1-ium-1-ylethyl)benzimidazol-1-ium-1-yl]-3,3-dimethylbutan-2-ol (PubChem CID 6942557) has the molecular formula C20H34N4O+2 and a molecular weight of 346.52 g/mol. Its IUPAC name is (2S)-1-[2-amino-3-(2-piperidin-1-ium-1-ylethyl)benzimidazol-1-ium-1-yl]-3,3-dimethylbutan-2-ol.
| Compound Name | (2S)-1-[2-amino-3-(2-piperidin-1-ium-1-ylethyl)benzimidazol-1-ium-1-yl]-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 6942557 |
| Molecular Formula | C20H34N4O+2 |
| Molecular Weight | 346.52 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | (2S)-1-[2-amino-3-(2-piperidin-1-ium-1-ylethyl)benzimidazol-1-ium-1-yl]-3,3-dimethylbutan-2-ol |
| SMILES | CC(C)(C)[C@H](O)C[n+]1c(N)n(CC[NH+]2CCCCC2)c2ccccc21 |
| InChI | InChI=1S/C20H32N4O/c1-20(2,3)18(25)15-24-17-10-6-5-9-16(17)23(19(24)21)14-13-22-11-7-4-8-12-22/h5-6,9-10,18,21,25H,4,7-8,11-15H2,1-3H3/p+2/t18-/m1/s1 |
| InChIKey | MWCSFYNDOUZTLZ-GOSISDBHSA-P |
| XLogP | 0.99 |
| TPSA | 59.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.52 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|