C23H30N4O3+2 — CID 6963114
(1R)-2-[2-amino-3-(2-piperidin-1-ium-1-ylethyl)benzimidazol-1-ium-1-yl]-1-(1,3-benzodioxol-5-yl)ethanol (PubChem CID 6963114) has the molecular formula C23H30N4O3+2 and a molecular weight of 410.52 g/mol. Its IUPAC name is (1R)-2-[2-amino-3-(2-piperidin-1-ium-1-ylethyl)benzimidazol-1-ium-1-yl]-1-(1,3-benzodioxol-5-yl)ethanol.
| Compound Name | (1R)-2-[2-amino-3-(2-piperidin-1-ium-1-ylethyl)benzimidazol-1-ium-1-yl]-1-(1,3-benzodioxol-5-yl)ethanol |
|---|---|
| PubChem CID | 6963114 |
| Molecular Formula | C23H30N4O3+2 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | (1R)-2-[2-amino-3-(2-piperidin-1-ium-1-ylethyl)benzimidazol-1-ium-1-yl]-1-(1,3-benzodioxol-5-yl)ethanol |
| SMILES | Nc1n(CC[NH+]2CCCCC2)c2ccccc2[n+]1C[C@H](O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H28N4O3/c24-23-26(13-12-25-10-4-1-5-11-25)18-6-2-3-7-19(18)27(23)15-20(28)17-8-9-21-22(14-17)30-16-29-21/h2-3,6-9,14,20,24,28H,1,4-5,10-13,15-16H2/p+2/t20-/m0/s1 |
| InChIKey | WFRCAMGEBHKJFW-FQEVSTJZSA-P |
| XLogP | 1.04 |
| TPSA | 77.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|