C19H23N2O3+ — CID 8005106
(1S)-1-(1,3-benzodioxol-5-yl)-2-(4-phenylpiperazin-1-ium-1-yl)ethanol (PubChem CID 8005106) has the molecular formula C19H23N2O3+ and a molecular weight of 327.40 g/mol. Its IUPAC name is (1S)-1-(1,3-benzodioxol-5-yl)-2-(4-phenylpiperazin-1-ium-1-yl)ethanol.
| Compound Name | (1S)-1-(1,3-benzodioxol-5-yl)-2-(4-phenylpiperazin-1-ium-1-yl)ethanol |
|---|---|
| PubChem CID | 8005106 |
| Molecular Formula | C19H23N2O3+ |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | (1S)-1-(1,3-benzodioxol-5-yl)-2-(4-phenylpiperazin-1-ium-1-yl)ethanol |
| SMILES | O[C@H](C[NH+]1CCN(c2ccccc2)CC1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H22N2O3/c22-17(15-6-7-18-19(12-15)24-14-23-18)13-20-8-10-21(11-9-20)16-4-2-1-3-5-16/h1-7,12,17,22H,8-11,13-14H2/p+1/t17-/m1/s1 |
| InChIKey | MQTGVINCFGNMPP-QGZVFWFLSA-O |
| XLogP | 0.85 |
| TPSA | 46.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |