C17H28N3O+ — CID 4022123
1-(2-amino-3-butylbenzimidazol-1-ium-1-yl)-3,3-dimethylbutan-2-ol (PubChem CID 4022123) has the molecular formula C17H28N3O+ and a molecular weight of 290.43 g/mol. Its IUPAC name is 1-(2-amino-3-butylbenzimidazol-1-ium-1-yl)-3,3-dimethylbutan-2-ol.
| Compound Name | 1-(2-amino-3-butylbenzimidazol-1-ium-1-yl)-3,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 4022123 |
| Molecular Formula | C17H28N3O+ |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 1-(2-amino-3-butylbenzimidazol-1-ium-1-yl)-3,3-dimethylbutan-2-ol |
| SMILES | CCCCn1c(N)[n+](CC(O)C(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C17H27N3O/c1-5-6-11-19-13-9-7-8-10-14(13)20(16(19)18)12-15(21)17(2,3)4/h7-10,15,18,21H,5-6,11-12H2,1-4H3/p+1 |
| InChIKey | PPPKRSGANMQAJU-UHFFFAOYSA-O |
| XLogP | 2.72 |
| TPSA | 55.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|