C24H34N4O3+2 — CID 6983915
(2S)-1-[2-amino-3-(2-piperidin-1-ium-1-ylethyl)benzimidazol-1-ium-1-yl]-3-(4-methoxyphenoxy)propan-2-ol (PubChem CID 6983915) has the molecular formula C24H34N4O3+2 and a molecular weight of 426.56 g/mol. Its IUPAC name is (2S)-1-[2-amino-3-(2-piperidin-1-ium-1-ylethyl)benzimidazol-1-ium-1-yl]-3-(4-methoxyphenoxy)propan-2-ol.
| Compound Name | (2S)-1-[2-amino-3-(2-piperidin-1-ium-1-ylethyl)benzimidazol-1-ium-1-yl]-3-(4-methoxyphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 6983915 |
| Molecular Formula | C24H34N4O3+2 |
| Molecular Weight | 426.56 g/mol |
| Exact Mass | 426.26 |
| IUPAC Name | (2S)-1-[2-amino-3-(2-piperidin-1-ium-1-ylethyl)benzimidazol-1-ium-1-yl]-3-(4-methoxyphenoxy)propan-2-ol |
| SMILES | COc1ccc(OC[C@@H](O)C[n+]2c(N)n(CC[NH+]3CCCCC3)c3ccccc32)cc1 |
| InChI | InChI=1S/C24H32N4O3/c1-30-20-9-11-21(12-10-20)31-18-19(29)17-28-23-8-4-3-7-22(23)27(24(28)25)16-15-26-13-5-2-6-14-26/h3-4,7-12,19,25,29H,2,5-6,13-18H2,1H3/p+2/t19-/m0/s1 |
| InChIKey | DGODGIALPBBEFJ-IBGZPJMESA-P |
| XLogP | 1.03 |
| TPSA | 77.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.56 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|