C19H26N4O2+2 — CID 6940259
(1S)-2-[2-amino-3-(2-pyrrolidin-1-ium-1-ylethyl)benzimidazol-1-ium-1-yl]-1-(furan-2-yl)ethanol (PubChem CID 6940259) has the molecular formula C19H26N4O2+2 and a molecular weight of 342.44 g/mol. Its IUPAC name is (1S)-2-[2-amino-3-(2-pyrrolidin-1-ium-1-ylethyl)benzimidazol-1-ium-1-yl]-1-(furan-2-yl)ethanol.
| Compound Name | (1S)-2-[2-amino-3-(2-pyrrolidin-1-ium-1-ylethyl)benzimidazol-1-ium-1-yl]-1-(furan-2-yl)ethanol |
|---|---|
| PubChem CID | 6940259 |
| Molecular Formula | C19H26N4O2+2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | (1S)-2-[2-amino-3-(2-pyrrolidin-1-ium-1-ylethyl)benzimidazol-1-ium-1-yl]-1-(furan-2-yl)ethanol |
| SMILES | Nc1n(CC[NH+]2CCCC2)c2ccccc2[n+]1C[C@H](O)c1ccco1 |
| InChI | InChI=1S/C19H24N4O2/c20-19-22(12-11-21-9-3-4-10-21)15-6-1-2-7-16(15)23(19)14-17(24)18-8-5-13-25-18/h1-2,5-8,13,17,20,24H,3-4,9-12,14H2/p+2/t17-/m0/s1 |
| InChIKey | MYLIWBUGKQFXNB-KRWDZBQOSA-P |
| XLogP | 0.52 |
| TPSA | 72.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|