C19H23N4O2+ — CID 3914531
1-(furan-2-yl)-2-[2-imino-3-(2-pyrrolidin-1-ium-1-ylethyl)benzimidazol-1-yl]ethanone (PubChem CID 3914531) has the molecular formula C19H23N4O2+ and a molecular weight of 339.42 g/mol. Its IUPAC name is 1-(furan-2-yl)-2-[2-imino-3-(2-pyrrolidin-1-ium-1-ylethyl)benzimidazol-1-yl]ethanone.
| Compound Name | 1-(furan-2-yl)-2-[2-imino-3-(2-pyrrolidin-1-ium-1-ylethyl)benzimidazol-1-yl]ethanone |
|---|---|
| PubChem CID | 3914531 |
| Molecular Formula | C19H23N4O2+ |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 1-(furan-2-yl)-2-[2-imino-3-(2-pyrrolidin-1-ium-1-ylethyl)benzimidazol-1-yl]ethanone |
| SMILES | [H]/N=c1\n(CC[NH+]2CCCC2)c2ccccc2n1CC(=O)c1ccco1 |
| InChI | InChI=1S/C19H22N4O2/c20-19-22(12-11-21-9-3-4-10-21)15-6-1-2-7-16(15)23(19)14-17(24)18-8-5-13-25-18/h1-2,5-8,13,20H,3-4,9-12,14H2/p+1/b20-19+ |
| InChIKey | RXQJAPIHKGXREH-FMQUCBEESA-O |
| XLogP | 1.08 |
| TPSA | 68.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |