C14H13NO2 — CID 62206434
2-(1,3-dihydroisoindol-2-yl)-1-(furan-2-yl)ethanone (PubChem CID 62206434) has the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. Its IUPAC name is 2-(1,3-dihydroisoindol-2-yl)-1-(furan-2-yl)ethanone.
| Compound Name | 2-(1,3-dihydroisoindol-2-yl)-1-(furan-2-yl)ethanone |
|---|---|
| PubChem CID | 62206434 |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | 2-(1,3-dihydroisoindol-2-yl)-1-(furan-2-yl)ethanone |
| SMILES | O=C(CN1Cc2ccccc2C1)c1ccco1 |
| InChI | InChI=1S/C14H13NO2/c16-13(14-6-3-7-17-14)10-15-8-11-4-1-2-5-12(11)9-15/h1-7H,8-10H2 |
| InChIKey | OWZJOJCFRXCWEL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |